C18H26N4O5 — CID 67877292
3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-methoxyhexanoic acid (PubChem CID 67877292) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-methoxyhexanoic acid.
| Compound Name | 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-methoxyhexanoic acid |
|---|---|
| PubChem CID | 67877292 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-[[4-(4-methanehydrazonoylanilino)-4-oxobutanoyl]amino]-5-methoxyhexanoic acid |
| SMILES | COC(C)CC(CC(=O)O)NC(=O)CCC(=O)Nc1ccc(C=NN)cc1 |
| InChI | InChI=1S/C18H26N4O5/c1-12(27-2)9-15(10-18(25)26)22-17(24)8-7-16(23)21-14-5-3-13(4-6-14)11-20-19/h3-6,11-12,15H,7-10,19H2,1-2H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | WKDQFUMNGJGXKV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|