C18H23ClN4O4 — CID 135404278
[amino-[4-[[4-[[(3S)-5-ethoxy-5-oxopent-1-yn-3-yl]amino]-4-oxobutanoyl]amino]phenyl]methylidene]azanium chloride (PubChem CID 135404278) has the molecular formula C18H23ClN4O4 and a molecular weight of 394.86 g/mol. Its IUPAC name is [amino-[4-[[4-[[(3S)-5-ethoxy-5-oxopent-1-yn-3-yl]amino]-4-oxobutanoyl]amino]phenyl]methylidene]azanium chloride.
| Compound Name | [amino-[4-[[4-[[(3S)-5-ethoxy-5-oxopent-1-yn-3-yl]amino]-4-oxobutanoyl]amino]phenyl]methylidene]azanium chloride |
|---|---|
| PubChem CID | 135404278 |
| Molecular Formula | C18H23ClN4O4 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [amino-[4-[[4-[[(3S)-5-ethoxy-5-oxopent-1-yn-3-yl]amino]-4-oxobutanoyl]amino]phenyl]methylidene]azanium chloride |
| SMILES | C#C[C@H](CC(=O)OCC)NC(=O)CCC(=O)Nc1ccc(C(N)=[NH2+])cc1.[Cl-] |
| InChI | InChI=1S/C18H22N4O4.ClH/c1-3-13(11-17(25)26-4-2)21-15(23)9-10-16(24)22-14-7-5-12(6-8-14)18(19)20;/h1,5-8,13H,4,9-11H2,2H3,(H3,19,20)(H,21,23)(H,22,24);1H/t13-;/m1./s1 |
| InChIKey | JTZJXWLQRZUDFJ-BTQNPOSSSA-N |
| XLogP | -4.06 |
| TPSA | 136.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|