C11H14ClN3O3 — CID 135479899
[amino-[4-(3-carboxypropanoylamino)phenyl]methylidene]azanium chloride (PubChem CID 135479899) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is [amino-[4-(3-carboxypropanoylamino)phenyl]methylidene]azanium chloride.
| Compound Name | [amino-[4-(3-carboxypropanoylamino)phenyl]methylidene]azanium chloride |
|---|---|
| PubChem CID | 135479899 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | [amino-[4-(3-carboxypropanoylamino)phenyl]methylidene]azanium chloride |
| SMILES | NC(=[NH2+])c1ccc(NC(=O)CCC(=O)O)cc1.[Cl-] |
| InChI | InChI=1S/C11H13N3O3.ClH/c12-11(13)7-1-3-8(4-2-7)14-9(15)5-6-10(16)17;/h1-4H,5-6H2,(H3,12,13)(H,14,15)(H,16,17);1H |
| InChIKey | LCGYSICNTXOCAI-UHFFFAOYSA-N |
| XLogP | -4.04 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|