C25H26N6O8 — CID 67600379
(2R)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid (PubChem CID 67600379) has the molecular formula C25H26N6O8 and a molecular weight of 538.52 g/mol. Its IUPAC name is (2R)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid.
| Compound Name | (2R)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 67600379 |
| Molecular Formula | C25H26N6O8 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | (2R)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-(4-methanehydrazonoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid |
| SMILES | CC(=O)[C@](C(=O)O)(N1C(=O)N[C@](C)(c2ccc(C=NN)cc2)C1=O)N(C(=O)[C@@H](N)CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H26N6O8/c1-14(32)25(22(37)38,30(17-6-4-3-5-7-17)20(35)18(26)12-19(33)34)31-21(36)24(2,29-23(31)39)16-10-8-15(9-11-16)13-28-27/h3-11,13,18H,12,26-27H2,1-2H3,(H,29,39)(H,33,34)(H,37,38)/t18-,24+,25+/m0/s1 |
| InChIKey | XAHCOWQOZIMXTD-PISWEHOVSA-N |
| XLogP | -0.05 |
| TPSA | 225.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|