C25H27N7O8 — CID 70092213
(2S)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-[4-(diaminomethylideneamino)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid (PubChem CID 70092213) has the molecular formula C25H27N7O8 and a molecular weight of 553.53 g/mol. Its IUPAC name is (2S)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-[4-(diaminomethylideneamino)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid.
| Compound Name | (2S)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-[4-(diaminomethylideneamino)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 70092213 |
| Molecular Formula | C25H27N7O8 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | (2S)-2-(N-[(2S)-2-amino-3-carboxypropanoyl]anilino)-2-[(4R)-4-[4-(diaminomethylideneamino)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-oxobutanoic acid |
| SMILES | CC(=O)[C@@](C(=O)O)(N1C(=O)N[C@](C)(c2ccc(N=C(N)N)cc2)C1=O)N(C(=O)[C@@H](N)CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H27N7O8/c1-13(33)25(21(38)39,31(16-6-4-3-5-7-16)19(36)17(26)12-18(34)35)32-20(37)24(2,30-23(32)40)14-8-10-15(11-9-14)29-22(27)28/h3-11,17H,12,26H2,1-2H3,(H,30,40)(H,34,35)(H,38,39)(H4,27,28,29)/t17-,24+,25-/m0/s1 |
| InChIKey | XXSRLUMUOOYZQJ-AJHZIAPWSA-N |
| XLogP | -0.44 |
| TPSA | 251.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|