About benzylidenehydrazine;oxalic acid
benzylidenehydrazine;oxalic acid (PubChem CID 162079614) has the molecular formula C16H18N4O4
and a molecular weight of 330.34 g/mol. Its IUPAC name is benzylidenehydrazine;oxalic acid.
Molecular Properties
| Compound Name | benzylidenehydrazine;oxalic acid |
| PubChem CID | 162079614 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | benzylidenehydrazine;oxalic acid |
| SMILES | NN=Cc1ccccc1.NN=Cc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C7H8N2.C2H2O4/c2*8-9-6-7-4-2-1-3-5-7;3-1(4)2(5)6/h2*1-6H,8H2;(H,3,4)(H,5,6) |
| InChIKey | ZCDXHIIVNIUVKG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 151.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzylidenehydrazine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylidenehydrazine;oxalic acid?
The IUPAC name of benzylidenehydrazine;oxalic acid (CID 162079614) is benzylidenehydrazine;oxalic acid.
What is the SMILES notation for benzylidenehydrazine;oxalic acid?
The canonical SMILES for benzylidenehydrazine;oxalic acid is NN=Cc1ccccc1.NN=Cc1ccccc1.O=C(O)C(=O)O.
What is the InChIKey of benzylidenehydrazine;oxalic acid?
The InChIKey is ZCDXHIIVNIUVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8N2.C2H2O4/c2*8-9-6-7-4-2-1-3-5-7;3-1(4)2(5)6/h2*1-6H,8H2;(H,3,4)(H,5,6).
What are the key properties of benzylidenehydrazine;oxalic acid?
benzylidenehydrazine;oxalic acid has a molecular weight of 330.34 g/mol, XLogP of 1.11, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzylidenehydrazine;oxalic acid is sourced from PubChem (CID 162079614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).