C18H20N4O3 — CID 67662567
2,3-diamino-2-benzoyl-4-(4-methanehydrazonoylphenyl)butanoic acid (PubChem CID 67662567) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2,3-diamino-2-benzoyl-4-(4-methanehydrazonoylphenyl)butanoic acid.
| Compound Name | 2,3-diamino-2-benzoyl-4-(4-methanehydrazonoylphenyl)butanoic acid |
|---|---|
| PubChem CID | 67662567 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2,3-diamino-2-benzoyl-4-(4-methanehydrazonoylphenyl)butanoic acid |
| SMILES | NN=Cc1ccc(CC(N)C(N)(C(=O)O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N4O3/c19-15(10-12-6-8-13(9-7-12)11-22-21)18(20,17(24)25)16(23)14-4-2-1-3-5-14/h1-9,11,15H,10,19-21H2,(H,24,25) |
| InChIKey | IIRYRDMKJCIWEO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|