C18H19NO4 — CID 70580752
2-amino-2-benzoyl-3-hydroxybutanoic acid;bicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 70580752) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-amino-2-benzoyl-3-hydroxybutanoic acid;bicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-amino-2-benzoyl-3-hydroxybutanoic acid;bicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 70580752 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-amino-2-benzoyl-3-hydroxybutanoic acid;bicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | CC(O)C(N)(C(=O)O)C(=O)c1ccccc1.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C11H13NO4.C7H6/c1-7(13)11(12,10(15)16)9(14)8-5-3-2-4-6-8;1-2-4-7-5-6(7)3-1/h2-7,13H,12H2,1H3,(H,15,16);1-4H,5H2 |
| InChIKey | AFKDAGQFARCOFY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|