C12H15NO4 — CID 174999891
(2S)-2-(aminomethyl)-2-benzoyl-3-hydroxybutanoic acid (PubChem CID 174999891) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is (2S)-2-(aminomethyl)-2-benzoyl-3-hydroxybutanoic acid.
| Compound Name | (2S)-2-(aminomethyl)-2-benzoyl-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 174999891 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2S)-2-(aminomethyl)-2-benzoyl-3-hydroxybutanoic acid |
| SMILES | CC(O)[C@](CN)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO4/c1-8(14)12(7-13,11(16)17)10(15)9-5-3-2-4-6-9/h2-6,8,14H,7,13H2,1H3,(H,16,17)/t8?,12-/m0/s1 |
| InChIKey | LLLCGXJUOPELON-MYIOLCAUSA-N |
| XLogP | 0.28 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|