C18H24N4O6 — CID 173329484
2-amino-2-(2-amino-4-oxobutanoyl)-3-(4-methanehydrazonoylphenyl)heptanedioic acid (PubChem CID 173329484) has the molecular formula C18H24N4O6 and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-amino-2-(2-amino-4-oxobutanoyl)-3-(4-methanehydrazonoylphenyl)heptanedioic acid.
| Compound Name | 2-amino-2-(2-amino-4-oxobutanoyl)-3-(4-methanehydrazonoylphenyl)heptanedioic acid |
|---|---|
| PubChem CID | 173329484 |
| Molecular Formula | C18H24N4O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-amino-2-(2-amino-4-oxobutanoyl)-3-(4-methanehydrazonoylphenyl)heptanedioic acid |
| SMILES | NN=Cc1ccc(C(CCCC(=O)O)C(N)(C(=O)O)C(=O)C(N)CC=O)cc1 |
| InChI | InChI=1S/C18H24N4O6/c19-14(8-9-23)16(26)18(20,17(27)28)13(2-1-3-15(24)25)12-6-4-11(5-7-12)10-22-21/h4-7,9-10,13-14H,1-3,8,19-21H2,(H,24,25)(H,27,28) |
| InChIKey | VGKLIAOJVHJJOF-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 199.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|