C15H20N4O4 — CID 173329444
2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-methyl-4,7-dioxoheptanoic acid (PubChem CID 173329444) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-methyl-4,7-dioxoheptanoic acid.
| Compound Name | 2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-methyl-4,7-dioxoheptanoic acid |
|---|---|
| PubChem CID | 173329444 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-methyl-4,7-dioxoheptanoic acid |
| SMILES | CC(N)(C(=O)O)C(N)(C(=O)CCC=O)c1ccc(C=NN)cc1 |
| InChI | InChI=1S/C15H20N4O4/c1-14(16,13(22)23)15(17,12(21)3-2-8-20)11-6-4-10(5-7-11)9-19-18/h4-9H,2-3,16-18H2,1H3,(H,22,23) |
| InChIKey | HMSMNKCIQYJNLL-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|