C17H22N4O6 — CID 173329425
2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-(4-oxobutanoyl)hexanedioic acid (PubChem CID 173329425) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is 2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-(4-oxobutanoyl)hexanedioic acid.
| Compound Name | 2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-(4-oxobutanoyl)hexanedioic acid |
|---|---|
| PubChem CID | 173329425 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2,3-diamino-3-(4-methanehydrazonoylphenyl)-2-(4-oxobutanoyl)hexanedioic acid |
| SMILES | NN=Cc1ccc(C(N)(CCC(=O)O)C(N)(C(=O)O)C(=O)CCC=O)cc1 |
| InChI | InChI=1S/C17H22N4O6/c18-16(8-7-14(24)25,12-5-3-11(4-6-12)10-21-20)17(19,15(26)27)13(23)2-1-9-22/h3-6,9-10H,1-2,7-8,18-20H2,(H,24,25)(H,26,27) |
| InChIKey | ZSNIVAIOZIZDJU-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 199.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|