About 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid
2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid (PubChem CID 173329385) has the molecular formula C15H20N4O5
and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid.
Molecular Properties
| Compound Name | 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid |
| PubChem CID | 173329385 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid |
| SMILES | NN=Cc1ccc(C(N)(CO)C(N)(C(=O)O)C(=O)CCC=O)cc1 |
| InChI | InChI=1S/C15H20N4O5/c16-14(9-21,11-5-3-10(4-6-11)8-19-18)15(17,13(23)24)12(22)2-1-7-20/h3-8,21H,1-2,9,16-18H2,(H,23,24) |
| InChIKey | PXPZQLJBJKZQPX-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 182.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid?
The IUPAC name of 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid (CID 173329385) is 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid.
What is the SMILES notation for 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid?
The canonical SMILES for 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid is NN=Cc1ccc(C(N)(CO)C(N)(C(=O)O)C(=O)CCC=O)cc1.
What is the InChIKey of 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid?
The InChIKey is PXPZQLJBJKZQPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O5/c16-14(9-21,11-5-3-10(4-6-11)8-19-18)15(17,13(23)24)12(22)2-1-7-20/h3-8,21H,1-2,9,16-18H2,(H,23,24).
What are the key properties of 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid?
2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid has a molecular weight of 336.35 g/mol, XLogP of -1.54, 9 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[1-amino-2-hydroxy-1-(4-methanehydrazonoylphenyl)ethyl]-3,6-dioxohexanoic acid is sourced from PubChem (CID 173329385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).