C23H22F3N3O9 — CID 67651066
5-acetyloxy-2-[(4-methanehydrazonoylbenzoyl)amino]-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67651066) has the molecular formula C23H22F3N3O9 and a molecular weight of 541.44 g/mol. Its IUPAC name is 5-acetyloxy-2-[(4-methanehydrazonoylbenzoyl)amino]-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-acetyloxy-2-[(4-methanehydrazonoylbenzoyl)amino]-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67651066 |
| Molecular Formula | C23H22F3N3O9 |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 5-acetyloxy-2-[(4-methanehydrazonoylbenzoyl)amino]-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)OCCC(=O)C(NC(=O)c1ccc(C=NN)cc1)(Oc1ccccc1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H21N3O7.C2HF3O2/c1-14(25)30-12-11-18(26)21(20(28)29,31-17-5-3-2-4-6-17)24-19(27)16-9-7-15(8-10-16)13-23-22;3-2(4,5)1(6)7/h2-10,13H,11-12,22H2,1H3,(H,24,27)(H,28,29);(H,6,7) |
| InChIKey | CKFPDYXMOIAWMN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 194.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|