C22H22F3N3O8 — CID 67649696
2-[(4-carbamimidoylbenzoyl)amino]-5-methoxy-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67649696) has the molecular formula C22H22F3N3O8 and a molecular weight of 513.43 g/mol. Its IUPAC name is 2-[(4-carbamimidoylbenzoyl)amino]-5-methoxy-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(4-carbamimidoylbenzoyl)amino]-5-methoxy-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67649696 |
| Molecular Formula | C22H22F3N3O8 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 2-[(4-carbamimidoylbenzoyl)amino]-5-methoxy-3-oxo-2-phenoxypentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(C(=O)NC(Oc2ccccc2)(C(=O)O)C(=O)CCOC)cc1 |
| InChI | InChI=1S/C20H21N3O6.C2HF3O2/c1-28-12-11-16(24)20(19(26)27,29-15-5-3-2-4-6-15)23-18(25)14-9-7-13(8-10-14)17(21)22;3-2(4,5)1(6)7/h2-10H,11-12H2,1H3,(H3,21,22)(H,23,25)(H,26,27);(H,6,7) |
| InChIKey | WLOFTYXPKKKHDB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 189.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|