C21H23N3O5 — CID 67649453
2-[(4-carbamimidoylbenzoyl)amino]-5-methyl-3-oxo-2-phenoxyhexanoic acid (PubChem CID 67649453) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[(4-carbamimidoylbenzoyl)amino]-5-methyl-3-oxo-2-phenoxyhexanoic acid.
| Compound Name | 2-[(4-carbamimidoylbenzoyl)amino]-5-methyl-3-oxo-2-phenoxyhexanoic acid |
|---|---|
| PubChem CID | 67649453 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[(4-carbamimidoylbenzoyl)amino]-5-methyl-3-oxo-2-phenoxyhexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(Oc2ccccc2)(C(=O)O)C(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C21H23N3O5/c1-13(2)12-17(25)21(20(27)28,29-16-6-4-3-5-7-16)24-19(26)15-10-8-14(9-11-15)18(22)23/h3-11,13H,12H2,1-2H3,(H3,22,23)(H,24,26)(H,27,28) |
| InChIKey | RUIPBLPBPYNMBH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|