C29H32F3N5O7 — CID 68652684
4-[[2-(2-benzoylhydrazinyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68652684) has the molecular formula C29H32F3N5O7 and a molecular weight of 619.60 g/mol. Its IUPAC name is 4-[[2-(2-benzoylhydrazinyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[2-(2-benzoylhydrazinyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68652684 |
| Molecular Formula | C29H32F3N5O7 |
| Molecular Weight | 619.60 g/mol |
| Exact Mass | 619.23 |
| IUPAC Name | 4-[[2-(2-benzoylhydrazinyl)-1-[3-ethoxy-4-(2-methoxyethoxy)phenyl]-2-oxoethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccccc2)c2ccc(OCCOC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C27H31N5O5.C2HF3O2/c1-3-36-23-17-20(11-14-22(23)37-16-15-35-2)24(30-21-12-9-18(10-13-21)25(28)29)27(34)32-31-26(33)19-7-5-4-6-8-19;3-2(4,5)1(6)7/h4-14,17,24,30H,3,15-16H2,1-2H3,(H3,28,29)(H,31,33)(H,32,34);(H,6,7) |
| InChIKey | ZYRLBZRDRZVYET-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 185.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|