C27H29F3N6O6 — CID 68652566
4-[[1-(3,4-diethoxyphenyl)-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68652566) has the molecular formula C27H29F3N6O6 and a molecular weight of 590.56 g/mol. Its IUPAC name is 4-[[1-(3,4-diethoxyphenyl)-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[1-(3,4-diethoxyphenyl)-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68652566 |
| Molecular Formula | C27H29F3N6O6 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | 4-[[1-(3,4-diethoxyphenyl)-2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]amino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(C(=O)NNC(=O)c2ccccn2)c2ccc(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C25H28N6O4.C2HF3O2/c1-3-34-20-13-10-17(15-21(20)35-4-2)22(29-18-11-8-16(9-12-18)23(26)27)25(33)31-30-24(32)19-7-5-6-14-28-19;3-2(4,5)1(6)7/h5-15,22,29H,3-4H2,1-2H3,(H3,26,27)(H,30,32)(H,31,33);(H,6,7) |
| InChIKey | KDAURCIOZLVXER-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 188.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|