C23H27N5O5 — CID 173329434
2-amino-2-[1-amino-3-(benzylamino)-1-(4-methanehydrazonoylphenyl)-3-oxopropyl]-3,6-dioxohexanoic acid (PubChem CID 173329434) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-amino-2-[1-amino-3-(benzylamino)-1-(4-methanehydrazonoylphenyl)-3-oxopropyl]-3,6-dioxohexanoic acid.
| Compound Name | 2-amino-2-[1-amino-3-(benzylamino)-1-(4-methanehydrazonoylphenyl)-3-oxopropyl]-3,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 173329434 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 2-amino-2-[1-amino-3-(benzylamino)-1-(4-methanehydrazonoylphenyl)-3-oxopropyl]-3,6-dioxohexanoic acid |
| SMILES | NN=Cc1ccc(C(N)(CC(=O)NCc2ccccc2)C(N)(C(=O)O)C(=O)CCC=O)cc1 |
| InChI | InChI=1S/C23H27N5O5/c24-22(18-10-8-17(9-11-18)15-28-26,23(25,21(32)33)19(30)7-4-12-29)13-20(31)27-14-16-5-2-1-3-6-16/h1-3,5-6,8-12,15H,4,7,13-14,24-26H2,(H,27,31)(H,32,33) |
| InChIKey | HJMOAWGYCIJPBX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 190.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|