C19H25ClN6O2 — CID 70090043
2-[(4-methanehydrazonoylphenyl)methylamino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]propanamide;hydrochloride (PubChem CID 70090043) has the molecular formula C19H25ClN6O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 2-[(4-methanehydrazonoylphenyl)methylamino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]propanamide;hydrochloride.
| Compound Name | 2-[(4-methanehydrazonoylphenyl)methylamino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 70090043 |
| Molecular Formula | C19H25ClN6O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[(4-methanehydrazonoylphenyl)methylamino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]propanamide;hydrochloride |
| SMILES | CC(NCc1ccc(C=NN)cc1)C(=O)NCC(=O)NCc1cccnc1.Cl |
| InChI | InChI=1S/C19H24N6O2.ClH/c1-14(22-10-15-4-6-16(7-5-15)12-25-20)19(27)24-13-18(26)23-11-17-3-2-8-21-9-17;/h2-9,12,14,22H,10-11,13,20H2,1H3,(H,23,26)(H,24,27);1H |
| InChIKey | FVMMKPHBVPUYCC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|