C24H24F3N3O4 — CID 87951279
ethyl 1-benzyl-4-[[4-[(Z)-hydrazinylidenemethyl]phenyl]methyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 87951279) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is ethyl 1-benzyl-4-[[4-[(Z)-hydrazinylidenemethyl]phenyl]methyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 1-benzyl-4-[[4-[(Z)-hydrazinylidenemethyl]phenyl]methyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87951279 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | ethyl 1-benzyl-4-[[4-[(Z)-hydrazinylidenemethyl]phenyl]methyl]pyrrole-3-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)c1cn(Cc2ccccc2)cc1Cc1ccc(/C=N\N)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H23N3O2.C2HF3O2/c1-2-27-22(26)21-16-25(14-19-6-4-3-5-7-19)15-20(21)12-17-8-10-18(11-9-17)13-24-23;3-2(4,5)1(6)7/h3-11,13,15-16H,2,12,14,23H2,1H3;(H,6,7)/b24-13-; |
| InChIKey | DZJVTZDRBHYJNX-QFPZOENFSA-N |
| XLogP | 4.23 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|