C27H27N5O2 — CID 10168786
ethyl 1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate (PubChem CID 10168786) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is ethyl 1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 10168786 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | ethyl 1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-4-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(Cc2cn(Cc3ccc4ccc(/C(N)=N/[H])cc4c3)cc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-2-34-27(33)24-16-32(15-23(24)11-17-3-7-20(8-4-17)25(28)29)14-18-5-6-19-9-10-21(26(30)31)13-22(19)12-18/h3-10,12-13,15-16H,2,11,14H2,1H3,(H3,28,29)(H3,30,31) |
| InChIKey | HTFZECBBWYWXSO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|