C22H23N3O2 — CID 10162539
ethyl 4-benzyl-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate (PubChem CID 10162539) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is ethyl 4-benzyl-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 4-benzyl-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 10162539 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | ethyl 4-benzyl-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(Cn2cc(Cc3ccccc3)c(C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C22H23N3O2/c1-2-27-22(26)20-15-25(13-17-8-10-18(11-9-17)21(23)24)14-19(20)12-16-6-4-3-5-7-16/h3-11,14-15H,2,12-13H2,1H3,(H3,23,24) |
| InChIKey | FYNZHXSBFWHSOF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|