C25H27N5O4 — CID 87951236
(2-ethoxy-2-oxoethyl) 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate (PubChem CID 87951236) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate.
| Compound Name | (2-ethoxy-2-oxoethyl) 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 87951236 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(Cc2c[nH]c(Cc3cccc(/C(N)=N/[H])c3)c2C(=O)OCC(=O)OCC)cc1 |
| InChI | InChI=1S/C25H27N5O4/c1-2-33-21(31)14-34-25(32)22-19(10-15-6-8-17(9-7-15)23(26)27)13-30-20(22)12-16-4-3-5-18(11-16)24(28)29/h3-9,11,13,30H,2,10,12,14H2,1H3,(H3,26,27)(H3,28,29) |
| InChIKey | PVHGGYMWEZWDCR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|