C28H29F6N5O6 — CID 87951437
propyl 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87951437) has the molecular formula C28H29F6N5O6 and a molecular weight of 645.56 g/mol. Its IUPAC name is propyl 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | propyl 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87951437 |
| Molecular Formula | C28H29F6N5O6 |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | propyl 2-[(3-carbamimidoylphenyl)methyl]-4-[(4-carbamimidoylphenyl)methyl]-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(Cc2c[nH]c(Cc3cccc(/C(N)=N/[H])c3)c2C(=O)OCCC)cc1 |
| InChI | InChI=1S/C24H27N5O2.2C2HF3O2/c1-2-10-31-24(30)21-19(11-15-6-8-17(9-7-15)22(25)26)14-29-20(21)13-16-4-3-5-18(12-16)23(27)28;2*3-2(4,5)1(6)7/h3-9,12,14,29H,2,10-11,13H2,1H3,(H3,25,26)(H3,27,28);2*(H,6,7) |
| InChIKey | ITIWBWDDYGCTPQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 216.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|