C28H26N4O2 — CID 118213166
N-[(4-carbamimidoylphenyl)methyl]-3-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]benzamide (PubChem CID 118213166) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-3-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]benzamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-3-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 118213166 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-3-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cccc(Cc3ccc(Cc4ccc[nH]c4=O)cc3)c2)cc1 |
| InChI | InChI=1S/C28H26N4O2/c29-26(30)23-12-10-21(11-13-23)18-32-28(34)24-4-1-3-22(17-24)15-19-6-8-20(9-7-19)16-25-5-2-14-31-27(25)33/h1-14,17H,15-16,18H2,(H3,29,30)(H,31,33)(H,32,34) |
| InChIKey | DSVYSIDICQGSSC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|