C29H25N5O2 — CID 118212715
N-[(8-aminoquinolin-3-yl)methyl]-2-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 118212715) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[(8-aminoquinolin-3-yl)methyl]-2-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | N-[(8-aminoquinolin-3-yl)methyl]-2-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118212715 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[(8-aminoquinolin-3-yl)methyl]-2-[[4-[(2-oxo-1H-pyridin-3-yl)methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Nc1cccc2cc(CNC(=O)c3ccnc(Cc4ccc(Cc5ccc[nH]c5=O)cc4)c3)cnc12 |
| InChI | InChI=1S/C29H25N5O2/c30-26-5-1-3-22-14-21(17-33-27(22)26)18-34-29(36)24-10-12-31-25(16-24)15-20-8-6-19(7-9-20)13-23-4-2-11-32-28(23)35/h1-12,14,16-17H,13,15,18,30H2,(H,32,35)(H,34,36) |
| InChIKey | WZQGIDPCERKTJX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|