C25H26ClN5O — CID 70255602
N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-1,7-dimethylbenzimidazole-5-carboxamide;hydrochloride (PubChem CID 70255602) has the molecular formula C25H26ClN5O and a molecular weight of 447.97 g/mol. Its IUPAC name is N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-1,7-dimethylbenzimidazole-5-carboxamide;hydrochloride.
| Compound Name | N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-1,7-dimethylbenzimidazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70255602 |
| Molecular Formula | C25H26ClN5O |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-benzyl-2-[(4-carbamimidoylphenyl)methyl]-1,7-dimethylbenzimidazole-5-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(Cc2nc3cc(C(=O)NCc4ccccc4)cc(C)c3n2C)cc1 |
| InChI | InChI=1S/C25H25N5O.ClH/c1-16-12-20(25(31)28-15-18-6-4-3-5-7-18)14-21-23(16)30(2)22(29-21)13-17-8-10-19(11-9-17)24(26)27;/h3-12,14H,13,15H2,1-2H3,(H3,26,27)(H,28,31);1H |
| InChIKey | LPWPZZVOKNZEFM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|