C19H21N3O — CID 91469012
4-[[[(E)-4-oxo-5-phenylpent-2-en-3-yl]amino]methyl]benzenecarboximidamide (PubChem CID 91469012) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-[[[(E)-4-oxo-5-phenylpent-2-en-3-yl]amino]methyl]benzenecarboximidamide.
| Compound Name | 4-[[[(E)-4-oxo-5-phenylpent-2-en-3-yl]amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 91469012 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-[[[(E)-4-oxo-5-phenylpent-2-en-3-yl]amino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN/C(=C/C)C(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-2-17(18(23)12-14-6-4-3-5-7-14)22-13-15-8-10-16(11-9-15)19(20)21/h2-11,22H,12-13H2,1H3,(H3,20,21)/b17-2+ |
| InChIKey | MPSBIDDHQJDURV-LAZPYJJCSA-N |
| XLogP | 2.78 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|