C23H23ClN6O — CID 23302227
2-[(4-carbamimidoylphenyl)methyl]-N,1-dimethyl-N-pyridin-3-ylbenzimidazole-5-carboxamide;hydrochloride (PubChem CID 23302227) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 2-[(4-carbamimidoylphenyl)methyl]-N,1-dimethyl-N-pyridin-3-ylbenzimidazole-5-carboxamide;hydrochloride.
| Compound Name | 2-[(4-carbamimidoylphenyl)methyl]-N,1-dimethyl-N-pyridin-3-ylbenzimidazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 23302227 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[(4-carbamimidoylphenyl)methyl]-N,1-dimethyl-N-pyridin-3-ylbenzimidazole-5-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(Cc2nc3cc(C(=O)N(C)c4cccnc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C23H22N6O.ClH/c1-28(18-4-3-11-26-14-18)23(30)17-9-10-20-19(13-17)27-21(29(20)2)12-15-5-7-16(8-6-15)22(24)25;/h3-11,13-14H,12H2,1-2H3,(H3,24,25);1H |
| InChIKey | ZMUQUNRFUGXLHQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|