C18H19N5O2 — CID 141031470
2-[(4-carbamimidoyl-N-methylanilino)methyl]-1-methylbenzimidazole-5-carboxylic acid (PubChem CID 141031470) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[(4-carbamimidoyl-N-methylanilino)methyl]-1-methylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-[(4-carbamimidoyl-N-methylanilino)methyl]-1-methylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 141031470 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[(4-carbamimidoyl-N-methylanilino)methyl]-1-methylbenzimidazole-5-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(N(C)Cc2nc3cc(C(=O)O)ccc3n2C)cc1 |
| InChI | InChI=1S/C18H19N5O2/c1-22(13-6-3-11(4-7-13)17(19)20)10-16-21-14-9-12(18(24)25)5-8-15(14)23(16)2/h3-9H,10H2,1-2H3,(H3,19,20)(H,24,25) |
| InChIKey | NWCDGVSZAUXEEX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|