C26H23N5O2S — CID 11113432
4-[[1-methyl-5-(naphthalen-2-ylsulfonylamino)benzimidazol-2-yl]methyl]benzenecarboximidamide (PubChem CID 11113432) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-[[1-methyl-5-(naphthalen-2-ylsulfonylamino)benzimidazol-2-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[1-methyl-5-(naphthalen-2-ylsulfonylamino)benzimidazol-2-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 11113432 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 4-[[1-methyl-5-(naphthalen-2-ylsulfonylamino)benzimidazol-2-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cc2nc3cc(NS(=O)(=O)c4ccc5ccccc5c4)ccc3n2C)cc1 |
| InChI | InChI=1S/C26H23N5O2S/c1-31-24-13-11-21(30-34(32,33)22-12-10-18-4-2-3-5-20(18)15-22)16-23(24)29-25(31)14-17-6-8-19(9-7-17)26(27)28/h2-13,15-16,30H,14H2,1H3,(H3,27,28) |
| InChIKey | SGSLVQYAGBCGFJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|