C41H42N6O3S — CID 139946120
4-[2-[5-[[4-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]naphthalen-2-yl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide (PubChem CID 139946120) has the molecular formula C41H42N6O3S and a molecular weight of 698.89 g/mol. Its IUPAC name is 4-[2-[5-[[4-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]naphthalen-2-yl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[5-[[4-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]naphthalen-2-yl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 139946120 |
| Molecular Formula | C41H42N6O3S |
| Molecular Weight | 698.89 g/mol |
| Exact Mass | 698.30 |
| IUPAC Name | 4-[2-[5-[[4-[2-(2-benzylpiperidin-1-yl)-2-oxoethyl]naphthalen-2-yl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(NS(=O)(=O)c4cc(CC(=O)N5CCCCC5Cc5ccccc5)c5ccccc5c4)ccc3n2C)cc1 |
| InChI | InChI=1S/C41H42N6O3S/c1-46-38-20-19-33(27-37(38)44-39(46)21-16-28-14-17-30(18-15-28)41(42)43)45-51(49,50)35-24-31-11-5-6-13-36(31)32(25-35)26-40(48)47-22-8-7-12-34(47)23-29-9-3-2-4-10-29/h2-6,9-11,13-15,17-20,24-25,27,34,45H,7-8,12,16,21-23,26H2,1H3,(H3,42,43) |
| InChIKey | MLFUJVCGKAAHPV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.89 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|