C37H44N6O2S — CID 70159096
4-[2-[5-[[2-[2-(diethylamino)ethyl]phenyl]sulfonylamino]-1-(3-phenylpropyl)benzimidazol-2-yl]ethyl]benzenecarboximidamide (PubChem CID 70159096) has the molecular formula C37H44N6O2S and a molecular weight of 636.87 g/mol. Its IUPAC name is 4-[2-[5-[[2-[2-(diethylamino)ethyl]phenyl]sulfonylamino]-1-(3-phenylpropyl)benzimidazol-2-yl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[5-[[2-[2-(diethylamino)ethyl]phenyl]sulfonylamino]-1-(3-phenylpropyl)benzimidazol-2-yl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 70159096 |
| Molecular Formula | C37H44N6O2S |
| Molecular Weight | 636.87 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | 4-[2-[5-[[2-[2-(diethylamino)ethyl]phenyl]sulfonylamino]-1-(3-phenylpropyl)benzimidazol-2-yl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(NS(=O)(=O)c4ccccc4CCN(CC)CC)ccc3n2CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H44N6O2S/c1-3-42(4-2)26-24-30-14-8-9-15-35(30)46(44,45)41-32-21-22-34-33(27-32)40-36(23-18-29-16-19-31(20-17-29)37(38)39)43(34)25-10-13-28-11-6-5-7-12-28/h5-9,11-12,14-17,19-22,27,41H,3-4,10,13,18,23-26H2,1-2H3,(H3,38,39) |
| InChIKey | ZWAGMCDWRPYIFR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.87 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|