C36H39ClN6O — CID 91394508
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-(3-phenylpropyl)benzimidazole-5-carboxamide (PubChem CID 91394508) has the molecular formula C36H39ClN6O and a molecular weight of 607.20 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-(3-phenylpropyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-(3-phenylpropyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 91394508 |
| Molecular Formula | C36H39ClN6O |
| Molecular Weight | 607.20 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[2-(4-chlorophenyl)ethyl]-N-(3-phenylpropyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)CCCc4ccccc4)ccc3n2CCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C36H39ClN6O/c37-31-16-10-28(11-17-31)20-23-43-33-18-15-30(36(44)42(24-21-38)22-4-7-26-5-2-1-3-6-26)25-32(33)41-34(43)19-12-27-8-13-29(14-9-27)35(39)40/h1-3,5-6,8-11,13-18,25H,4,7,12,19-24,38H2,(H3,39,40) |
| InChIKey | PNIWYDDYSFXWPD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.20 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|