C33H36N6OS — CID 70033657
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(3-phenylpropyl)-1-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 70033657) has the molecular formula C33H36N6OS and a molecular weight of 564.76 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(3-phenylpropyl)-1-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(3-phenylpropyl)-1-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70033657 |
| Molecular Formula | C33H36N6OS |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(3-phenylpropyl)-1-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)CCCc4ccccc4)ccc3n2Cc2cccs2)cc1 |
| InChI | InChI=1S/C33H36N6OS/c34-18-20-38(19-4-8-24-6-2-1-3-7-24)33(40)27-15-16-30-29(22-27)37-31(39(30)23-28-9-5-21-41-28)17-12-25-10-13-26(14-11-25)32(35)36/h1-3,5-7,9-11,13-16,21-22H,4,8,12,17-20,23,34H2,(H3,35,36) |
| InChIKey | WYFYITJGUDGHLX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|