C30H33FN6O — CID 18674411
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(cyclopropylmethyl)-N-[(2-fluorophenyl)methyl]benzimidazole-5-carboxamide (PubChem CID 18674411) has the molecular formula C30H33FN6O and a molecular weight of 512.63 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(cyclopropylmethyl)-N-[(2-fluorophenyl)methyl]benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(cyclopropylmethyl)-N-[(2-fluorophenyl)methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674411 |
| Molecular Formula | C30H33FN6O |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-1-(cyclopropylmethyl)-N-[(2-fluorophenyl)methyl]benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)Cc4ccccc4F)ccc3n2CC2CC2)cc1 |
| InChI | InChI=1S/C30H33FN6O/c31-25-4-2-1-3-24(25)19-36(16-15-32)30(38)23-12-13-27-26(17-23)35-28(37(27)18-21-5-6-21)14-9-20-7-10-22(11-8-20)29(33)34/h1-4,7-8,10-13,17,21H,5-6,9,14-16,18-19,32H2,(H3,33,34) |
| InChIKey | FOOOIWZLHIWNQA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|