C37H36N6OS — CID 18674291
N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(naphthalen-2-ylmethyl)-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide (PubChem CID 18674291) has the molecular formula C37H36N6OS and a molecular weight of 612.80 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(naphthalen-2-ylmethyl)-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(naphthalen-2-ylmethyl)-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18674291 |
| Molecular Formula | C37H36N6OS |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(4-carbamimidoylphenyl)ethyl]-N-(naphthalen-2-ylmethyl)-1-[(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)Cc4ccc5ccccc5c4)ccc3n2CC2=CC=CCC2=S)cc1 |
| InChI | InChI=1S/C37H36N6OS/c38-19-20-42(23-26-11-13-27-5-1-2-6-29(27)21-26)37(44)30-16-17-33-32(22-30)41-35(43(33)24-31-7-3-4-8-34(31)45)18-12-25-9-14-28(15-10-25)36(39)40/h1-7,9-11,13-17,21-22H,8,12,18-20,23-24,38H2,(H3,39,40) |
| InChIKey | NVADZFIGLPJAEC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|