C34H43N7O2 — CID 91451264
N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[3-[(2-phenylacetyl)amino]propyl]benzimidazole-5-carboxamide (PubChem CID 91451264) has the molecular formula C34H43N7O2 and a molecular weight of 581.77 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[3-[(2-phenylacetyl)amino]propyl]benzimidazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[3-[(2-phenylacetyl)amino]propyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 91451264 |
| Molecular Formula | C34H43N7O2 |
| Molecular Weight | 581.77 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | N-(2-aminoethyl)-N-butyl-2-[2-(4-carbamimidoylphenyl)ethyl]-1-[3-[(2-phenylacetyl)amino]propyl]benzimidazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCN)CCCC)ccc3n2CCCNC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H43N7O2/c1-2-3-20-40(22-18-35)34(43)28-15-16-30-29(24-28)39-31(17-12-25-10-13-27(14-11-25)33(36)37)41(30)21-7-19-38-32(42)23-26-8-5-4-6-9-26/h4-6,8-11,13-16,24H,2-3,7,12,17-23,35H2,1H3,(H3,36,37)(H,38,42) |
| InChIKey | NBFKZBHKBHMBAI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|