C25H25N5O4S — CID 23302430
ethyl 2-[6-(benzenesulfonamido)-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate (PubChem CID 23302430) has the molecular formula C25H25N5O4S and a molecular weight of 491.57 g/mol. Its IUPAC name is ethyl 2-[6-(benzenesulfonamido)-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[6-(benzenesulfonamido)-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 23302430 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | ethyl 2-[6-(benzenesulfonamido)-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(Cc2nc3ccc(NS(=O)(=O)c4ccccc4)cc3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C25H25N5O4S/c1-2-34-24(31)16-30-22-15-19(29-35(32,33)20-6-4-3-5-7-20)12-13-21(22)28-23(30)14-17-8-10-18(11-9-17)25(26)27/h3-13,15,29H,2,14,16H2,1H3,(H3,26,27) |
| InChIKey | NWGYZBWNTYOQPS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|