C16H18N4O — CID 58653927
N-[(2-amino-4-carbamimidoylphenyl)methyl]-3-methylbenzamide (PubChem CID 58653927) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[(2-amino-4-carbamimidoylphenyl)methyl]-3-methylbenzamide.
| Compound Name | N-[(2-amino-4-carbamimidoylphenyl)methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 58653927 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[(2-amino-4-carbamimidoylphenyl)methyl]-3-methylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2cccc(C)c2)c(N)c1 |
| InChI | InChI=1S/C16H18N4O/c1-10-3-2-4-12(7-10)16(21)20-9-13-6-5-11(15(18)19)8-14(13)17/h2-8H,9,17H2,1H3,(H3,18,19)(H,20,21) |
| InChIKey | AHDVLVKDKLTMSB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|