C23H25N5O2 — CID 10211415
ethyl 4-[(3-carbamimidoylphenyl)methyl]-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate (PubChem CID 10211415) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is ethyl 4-[(3-carbamimidoylphenyl)methyl]-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate.
| Compound Name | ethyl 4-[(3-carbamimidoylphenyl)methyl]-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 10211415 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | ethyl 4-[(3-carbamimidoylphenyl)methyl]-1-[(4-carbamimidoylphenyl)methyl]pyrrole-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(Cn2cc(Cc3cccc(/C(N)=N/[H])c3)c(C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-2-30-23(29)20-14-28(12-15-6-8-17(9-7-15)21(24)25)13-19(20)11-16-4-3-5-18(10-16)22(26)27/h3-10,13-14H,2,11-12H2,1H3,(H3,24,25)(H3,26,27) |
| InChIKey | NWMKPZUITWVJGK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 130.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|