C17H25N5O3 — CID 175999848
ethyl 4-[(2S)-2-amino-3-(3-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylate (PubChem CID 175999848) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl 4-[(2S)-2-amino-3-(3-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2S)-2-amino-3-(3-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175999848 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | ethyl 4-[(2S)-2-amino-3-(3-carbamimidoylphenyl)propanoyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](N)C(=O)N2CCN(C(=O)OCC)CC2)c1 |
| InChI | InChI=1S/C17H25N5O3/c1-2-25-17(24)22-8-6-21(7-9-22)16(23)14(18)11-12-4-3-5-13(10-12)15(19)20/h3-5,10,14H,2,6-9,11,18H2,1H3,(H3,19,20)/t14-/m0/s1 |
| InChIKey | YXXJMRUUFFDQKR-AWEZNQCLSA-N |
| XLogP | 0.14 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|