C25H31N5O4 — CID 10276641
methyl 3-(3-carbamimidoylphenyl)-2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]propanoate (PubChem CID 10276641) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is methyl 3-(3-carbamimidoylphenyl)-2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]propanoate.
| Compound Name | methyl 3-(3-carbamimidoylphenyl)-2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 10276641 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | methyl 3-(3-carbamimidoylphenyl)-2-[[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(NC(=O)c2ccc(OC3CCN(/C(C)=N/[H])CC3)cc2)C(=O)OC)c1 |
| InChI | InChI=1S/C25H31N5O4/c1-16(26)30-12-10-21(11-13-30)34-20-8-6-18(7-9-20)24(31)29-22(25(32)33-2)15-17-4-3-5-19(14-17)23(27)28/h3-9,14,21-22,26H,10-13,15H2,1-2H3,(H3,27,28)(H,29,31)/b26-16+ |
| InChIKey | UQRPMDXROXEPLP-WGOQTCKBSA-N |
| XLogP | 2.33 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|