C25H30N4O7 — CID 11648982
2-[4-carbamimidoyl-2-[2-[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid (PubChem CID 11648982) has the molecular formula C25H30N4O7 and a molecular weight of 498.54 g/mol. Its IUPAC name is 2-[4-carbamimidoyl-2-[2-[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid.
| Compound Name | 2-[4-carbamimidoyl-2-[2-[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11648982 |
| Molecular Formula | C25H30N4O7 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 2-[4-carbamimidoyl-2-[2-[4-(1-ethanimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCC(=O)O)c(OCCOC(=O)c2ccc(OC3CCN(/C(C)=N/[H])CC3)cc2)c1 |
| InChI | InChI=1S/C25H30N4O7/c1-16(26)29-10-8-20(9-11-29)36-19-5-2-17(3-6-19)25(32)34-13-12-33-22-14-18(24(27)28)4-7-21(22)35-15-23(30)31/h2-7,14,20,26H,8-13,15H2,1H3,(H3,27,28)(H,30,31)/b26-16+ |
| InChIKey | SGRRAYULJHTXEJ-WGOQTCKBSA-N |
| XLogP | 2.51 |
| TPSA | 168.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|