C24H30N6OS — CID 139854680
2-[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]methylsulfanyl]-1-ethylbenzimidazole-5-carboximidamide (PubChem CID 139854680) has the molecular formula C24H30N6OS and a molecular weight of 450.61 g/mol. Its IUPAC name is 2-[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]methylsulfanyl]-1-ethylbenzimidazole-5-carboximidamide.
| Compound Name | 2-[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]methylsulfanyl]-1-ethylbenzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 139854680 |
| Molecular Formula | C24H30N6OS |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]methylsulfanyl]-1-ethylbenzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)nc(SCc1ccc(OC3CCN(/C(C)=N/[H])CC3)cc1)n2CC |
| InChI | InChI=1S/C24H30N6OS/c1-3-30-22-9-6-18(23(26)27)14-21(22)28-24(30)32-15-17-4-7-19(8-5-17)31-20-10-12-29(13-11-20)16(2)25/h4-9,14,20,25H,3,10-13,15H2,1-2H3,(H3,26,27)/b25-16+ |
| InChIKey | VDJUOAQGYRGXNH-PCLIKHOPSA-N |
| XLogP | 4.47 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|