C29H37N5O3S — CID 15392310
7-[[N-butylsulfonyl-4-(1-ethanimidoylpiperidin-4-yl)oxyanilino]methyl]naphthalene-2-carboximidamide (PubChem CID 15392310) has the molecular formula C29H37N5O3S and a molecular weight of 535.71 g/mol. Its IUPAC name is 7-[[N-butylsulfonyl-4-(1-ethanimidoylpiperidin-4-yl)oxyanilino]methyl]naphthalene-2-carboximidamide.
| Compound Name | 7-[[N-butylsulfonyl-4-(1-ethanimidoylpiperidin-4-yl)oxyanilino]methyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 15392310 |
| Molecular Formula | C29H37N5O3S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 7-[[N-butylsulfonyl-4-(1-ethanimidoylpiperidin-4-yl)oxyanilino]methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN(c3ccc(OC4CCN(/C(C)=N/[H])CC4)cc3)S(=O)(=O)CCCC)cc2c1 |
| InChI | InChI=1S/C29H37N5O3S/c1-3-4-17-38(35,36)34(20-22-5-6-23-7-8-24(29(31)32)19-25(23)18-22)26-9-11-27(12-10-26)37-28-13-15-33(16-14-28)21(2)30/h5-12,18-19,28,30H,3-4,13-17,20H2,1-2H3,(H3,31,32)/b30-21+ |
| InChIKey | YJUHKINZFAEVOU-MWAVMZGNSA-N |
| XLogP | 5.10 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|