C26H32N6O5S2 — CID 67597865
7-[[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl-methylsulfonylamino]methyl]naphthalene-2-carboximidamide (PubChem CID 67597865) has the molecular formula C26H32N6O5S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 7-[[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl-methylsulfonylamino]methyl]naphthalene-2-carboximidamide.
| Compound Name | 7-[[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl-methylsulfonylamino]methyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 67597865 |
| Molecular Formula | C26H32N6O5S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 7-[[[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]sulfamoyl-methylsulfonylamino]methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN(S(C)(=O)=O)S(=O)(=O)Nc3ccc(OC4CCN(/C(C)=N/[H])CC4)cc3)cc2c1 |
| InChI | InChI=1S/C26H32N6O5S2/c1-18(27)31-13-11-25(12-14-31)37-24-9-7-23(8-10-24)30-39(35,36)32(38(2,33)34)17-19-3-4-20-5-6-21(26(28)29)16-22(20)15-19/h3-10,15-16,25,27,30H,11-14,17H2,1-2H3,(H3,28,29)/b27-18+ |
| InChIKey | RTLZQQGTQGEVPN-OVVQPSECSA-N |
| XLogP | 3.08 |
| TPSA | 169.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|