C27H33N5O3S — CID 15392280
7-[[4-(1-ethanimidoylpiperidin-4-yl)oxy-N-ethylsulfonylanilino]methyl]naphthalene-2-carboximidamide (PubChem CID 15392280) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is 7-[[4-(1-ethanimidoylpiperidin-4-yl)oxy-N-ethylsulfonylanilino]methyl]naphthalene-2-carboximidamide.
| Compound Name | 7-[[4-(1-ethanimidoylpiperidin-4-yl)oxy-N-ethylsulfonylanilino]methyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 15392280 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 7-[[4-(1-ethanimidoylpiperidin-4-yl)oxy-N-ethylsulfonylanilino]methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN(c3ccc(OC4CCN(/C(C)=N/[H])CC4)cc3)S(=O)(=O)CC)cc2c1 |
| InChI | InChI=1S/C27H33N5O3S/c1-3-36(33,34)32(18-20-4-5-21-6-7-22(27(29)30)17-23(21)16-20)24-8-10-25(11-9-24)35-26-12-14-31(15-13-26)19(2)28/h4-11,16-17,26,28H,3,12-15,18H2,1-2H3,(H3,29,30)/b28-19+ |
| InChIKey | AWNSKBBMLLSVDC-TURZUDJPSA-N |
| XLogP | 4.32 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|