C29H36N4O5S — CID 15392347
ethyl 2-[(7-carbamimidoylnaphthalen-2-yl)methyl-(4-piperidin-4-yloxyphenyl)sulfamoyl]butanoate (PubChem CID 15392347) has the molecular formula C29H36N4O5S and a molecular weight of 552.70 g/mol. Its IUPAC name is ethyl 2-[(7-carbamimidoylnaphthalen-2-yl)methyl-(4-piperidin-4-yloxyphenyl)sulfamoyl]butanoate.
| Compound Name | ethyl 2-[(7-carbamimidoylnaphthalen-2-yl)methyl-(4-piperidin-4-yloxyphenyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 15392347 |
| Molecular Formula | C29H36N4O5S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | ethyl 2-[(7-carbamimidoylnaphthalen-2-yl)methyl-(4-piperidin-4-yloxyphenyl)sulfamoyl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN(c3ccc(OC4CCNCC4)cc3)S(=O)(=O)C(CC)C(=O)OCC)cc2c1 |
| InChI | InChI=1S/C29H36N4O5S/c1-3-27(29(34)37-4-2)39(35,36)33(24-9-11-25(12-10-24)38-26-13-15-32-16-14-26)19-20-5-6-21-7-8-22(28(30)31)18-23(21)17-20/h5-12,17-18,26-27,32H,3-4,13-16,19H2,1-2H3,(H3,30,31) |
| InChIKey | MSAPTHKMMXXULN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|